C12H20N2O — CID 105114625
1-(3,6-dimethylpyridazin-4-yl)-2-ethylbutan-1-ol (PubChem CID 105114625) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(3,6-dimethylpyridazin-4-yl)-2-ethylbutan-1-ol.
| Compound Name | 1-(3,6-dimethylpyridazin-4-yl)-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 105114625 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(3,6-dimethylpyridazin-4-yl)-2-ethylbutan-1-ol |
| SMILES | CCC(CC)C(O)c1cc(C)nnc1C |
| InChI | InChI=1S/C12H20N2O/c1-5-10(6-2)12(15)11-7-8(3)13-14-9(11)4/h7,10,12,15H,5-6H2,1-4H3 |
| InChIKey | WRKALOXADUKJNZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |