C7H15N5O — CID 105231129
4-(2-ethoxy-1-hydrazinylethyl)-1H-pyrazol-5-amine (PubChem CID 105231129) has the molecular formula C7H15N5O and a molecular weight of 185.23 g/mol. Its IUPAC name is 4-(2-ethoxy-1-hydrazinylethyl)-1H-pyrazol-5-amine.
| Compound Name | 4-(2-ethoxy-1-hydrazinylethyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 105231129 |
| Molecular Formula | C7H15N5O |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | 4-(2-ethoxy-1-hydrazinylethyl)-1H-pyrazol-5-amine |
| SMILES | CCOCC(NN)c1cn[nH]c1N |
| InChI | InChI=1S/C7H15N5O/c1-2-13-4-6(11-9)5-3-10-12-7(5)8/h3,6,11H,2,4,9H2,1H3,(H3,8,10,12) |
| InChIKey | IPOZLCNJRQFELV-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|