C10H15N5S — CID 105231214
4-(1-hydrazinyl-3-thiophen-3-ylpropyl)-1H-pyrazol-5-amine (PubChem CID 105231214) has the molecular formula C10H15N5S and a molecular weight of 237.33 g/mol. Its IUPAC name is 4-(1-hydrazinyl-3-thiophen-3-ylpropyl)-1H-pyrazol-5-amine.
| Compound Name | 4-(1-hydrazinyl-3-thiophen-3-ylpropyl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 105231214 |
| Molecular Formula | C10H15N5S |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 4-(1-hydrazinyl-3-thiophen-3-ylpropyl)-1H-pyrazol-5-amine |
| SMILES | NNC(CCc1ccsc1)c1cn[nH]c1N |
| InChI | InChI=1S/C10H15N5S/c11-10-8(5-13-15-10)9(14-12)2-1-7-3-4-16-6-7/h3-6,9,14H,1-2,12H2,(H3,11,13,15) |
| InChIKey | CFXAAPQXISESGM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|