C10H16ClN7 — CID 105231314
4-[2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-hydrazinylethyl]-1H-pyrazol-5-amine (PubChem CID 105231314) has the molecular formula C10H16ClN7 and a molecular weight of 269.74 g/mol. Its IUPAC name is 4-[2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-hydrazinylethyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-hydrazinylethyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 105231314 |
| Molecular Formula | C10H16ClN7 |
| Molecular Weight | 269.74 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-[2-(4-chloro-1,3-dimethylpyrazol-5-yl)-1-hydrazinylethyl]-1H-pyrazol-5-amine |
| SMILES | Cc1nn(C)c(CC(NN)c2cn[nH]c2N)c1Cl |
| InChI | InChI=1S/C10H16ClN7/c1-5-9(11)8(18(2)17-5)3-7(15-13)6-4-14-16-10(6)12/h4,7,15H,3,13H2,1-2H3,(H3,12,14,16) |
| InChIKey | IRIWCONPFFLFEQ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.74 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|