C11H11Cl2N3O — CID 65362046
1-(5-amino-1H-pyrazol-4-yl)-2-(2,5-dichlorophenyl)ethanol (PubChem CID 65362046) has the molecular formula C11H11Cl2N3O and a molecular weight of 272.13 g/mol. Its IUPAC name is 1-(5-amino-1H-pyrazol-4-yl)-2-(2,5-dichlorophenyl)ethanol.
| Compound Name | 1-(5-amino-1H-pyrazol-4-yl)-2-(2,5-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 65362046 |
| Molecular Formula | C11H11Cl2N3O |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 1-(5-amino-1H-pyrazol-4-yl)-2-(2,5-dichlorophenyl)ethanol |
| SMILES | Nc1[nH]ncc1C(O)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H11Cl2N3O/c12-7-1-2-9(13)6(3-7)4-10(17)8-5-15-16-11(8)14/h1-3,5,10,17H,4H2,(H3,14,15,16) |
| InChIKey | GTCROBRTXPMMKN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |