C11H11BrFN3O — CID 65362157
1-(5-amino-1H-pyrazol-4-yl)-2-(5-bromo-2-fluorophenyl)ethanol (PubChem CID 65362157) has the molecular formula C11H11BrFN3O and a molecular weight of 300.13 g/mol. Its IUPAC name is 1-(5-amino-1H-pyrazol-4-yl)-2-(5-bromo-2-fluorophenyl)ethanol.
| Compound Name | 1-(5-amino-1H-pyrazol-4-yl)-2-(5-bromo-2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 65362157 |
| Molecular Formula | C11H11BrFN3O |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 1-(5-amino-1H-pyrazol-4-yl)-2-(5-bromo-2-fluorophenyl)ethanol |
| SMILES | Nc1[nH]ncc1C(O)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C11H11BrFN3O/c12-7-1-2-9(13)6(3-7)4-10(17)8-5-15-16-11(8)14/h1-3,5,10,17H,4H2,(H3,14,15,16) |
| InChIKey | YEXURSFBSUQHLX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |