C9H9ClFNO3 — CID 171862138
2-(3-chloro-1,2-dihydroxypropyl)-5-fluoropyridine-4-carbaldehyde (PubChem CID 171862138) has the molecular formula C9H9ClFNO3 and a molecular weight of 233.63 g/mol. Its IUPAC name is 2-(3-chloro-1,2-dihydroxypropyl)-5-fluoropyridine-4-carbaldehyde.
| Compound Name | 2-(3-chloro-1,2-dihydroxypropyl)-5-fluoropyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 171862138 |
| Molecular Formula | C9H9ClFNO3 |
| Molecular Weight | 233.63 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 2-(3-chloro-1,2-dihydroxypropyl)-5-fluoropyridine-4-carbaldehyde |
| SMILES | O=Cc1cc(C(O)C(O)CCl)ncc1F |
| InChI | InChI=1S/C9H9ClFNO3/c10-2-8(14)9(15)7-1-5(4-13)6(11)3-12-7/h1,3-4,8-9,14-15H,2H2 |
| InChIKey | GEFDPYJSDISSTH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.63 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|