C10H14BrN3O4 — CID 171892731
methyl 3-amino-6-(4-bromo-1,2-dihydroxybutyl)pyrazine-2-carboxylate (PubChem CID 171892731) has the molecular formula C10H14BrN3O4 and a molecular weight of 320.14 g/mol. Its IUPAC name is methyl 3-amino-6-(4-bromo-1,2-dihydroxybutyl)pyrazine-2-carboxylate.
| Compound Name | methyl 3-amino-6-(4-bromo-1,2-dihydroxybutyl)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 171892731 |
| Molecular Formula | C10H14BrN3O4 |
| Molecular Weight | 320.14 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | methyl 3-amino-6-(4-bromo-1,2-dihydroxybutyl)pyrazine-2-carboxylate |
| SMILES | COC(=O)c1nc(C(O)C(O)CCBr)cnc1N |
| InChI | InChI=1S/C10H14BrN3O4/c1-18-10(17)7-9(12)13-4-5(14-7)8(16)6(15)2-3-11/h4,6,8,15-16H,2-3H2,1H3,(H2,12,13) |
| InChIKey | WOMWGMJKWCPMCR-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.14 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|