C10H13NO4 — CID 171872080
6-(1,2,4-trihydroxybutyl)pyridine-3-carbaldehyde (PubChem CID 171872080) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 6-(1,2,4-trihydroxybutyl)pyridine-3-carbaldehyde.
| Compound Name | 6-(1,2,4-trihydroxybutyl)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 171872080 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 6-(1,2,4-trihydroxybutyl)pyridine-3-carbaldehyde |
| SMILES | O=Cc1ccc(C(O)C(O)CCO)nc1 |
| InChI | InChI=1S/C10H13NO4/c12-4-3-9(14)10(15)8-2-1-7(6-13)5-11-8/h1-2,5-6,9-10,12,14-15H,3-4H2 |
| InChIKey | QYRAUAYHWKRSBB-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|