C12H14N2O4 — CID 171873061
5-(1,2,4-trihydroxybutyl)-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde (PubChem CID 171873061) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 5-(1,2,4-trihydroxybutyl)-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde.
| Compound Name | 5-(1,2,4-trihydroxybutyl)-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 171873061 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 5-(1,2,4-trihydroxybutyl)-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde |
| SMILES | O=Cc1c[nH]c2ncc(C(O)C(O)CCO)cc12 |
| InChI | InChI=1S/C12H14N2O4/c15-2-1-10(17)11(18)7-3-9-8(6-16)5-14-12(9)13-4-7/h3-6,10-11,15,17-18H,1-2H2,(H,13,14) |
| InChIKey | MPPROEISAYEXGJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|