C12H19N3O3 — CID 171873099
1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol (PubChem CID 171873099) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol.
| Compound Name | 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171873099 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1cnc(N2CCCC2)nc1 |
| InChI | InChI=1S/C12H19N3O3/c16-6-3-10(17)11(18)9-7-13-12(14-8-9)15-4-1-2-5-15/h7-8,10-11,16-18H,1-6H2 |
| InChIKey | MINVFZREXHTSME-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |