About 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol
1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol (PubChem CID 171873099) has the molecular formula C12H19N3O3
and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol.
Molecular Properties
| Compound Name | 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol |
| PubChem CID | 171873099 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1cnc(N2CCCC2)nc1 |
| InChI | InChI=1S/C12H19N3O3/c16-6-3-10(17)11(18)9-7-13-12(14-8-9)15-4-1-2-5-15/h7-8,10-11,16-18H,1-6H2 |
| InChIKey | MINVFZREXHTSME-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol?
The IUPAC name of 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol (CID 171873099) is 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol.
What is the SMILES notation for 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol?
The canonical SMILES for 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol is OCCC(O)C(O)c1cnc(N2CCCC2)nc1.
What is the InChIKey of 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol?
The InChIKey is MINVFZREXHTSME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3/c16-6-3-10(17)11(18)9-7-13-12(14-8-9)15-4-1-2-5-15/h7-8,10-11,16-18H,1-6H2.
What are the key properties of 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol?
1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol has a molecular weight of 253.30 g/mol, XLogP of -0.15, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-pyrrolidin-1-ylpyrimidin-5-yl)butane-1,2,4-triol is sourced from PubChem (CID 171873099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).