C15H23F3N2O4 — CID 162722759
ethane;methoxymethane;2,2,2-trifluoro-N-[3-(5-formyl-2-pyridinyl)-3-hydroxypropyl]acetamide (PubChem CID 162722759) has the molecular formula C15H23F3N2O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is ethane;methoxymethane;2,2,2-trifluoro-N-[3-(5-formyl-2-pyridinyl)-3-hydroxypropyl]acetamide.
| Compound Name | ethane;methoxymethane;2,2,2-trifluoro-N-[3-(5-formyl-2-pyridinyl)-3-hydroxypropyl]acetamide |
|---|---|
| PubChem CID | 162722759 |
| Molecular Formula | C15H23F3N2O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | ethane;methoxymethane;2,2,2-trifluoro-N-[3-(5-formyl-2-pyridinyl)-3-hydroxypropyl]acetamide |
| SMILES | CC.COC.O=Cc1ccc(C(O)CCNC(=O)C(F)(F)F)nc1 |
| InChI | InChI=1S/C11H11F3N2O3.C2H6O.C2H6/c12-11(13,14)10(19)15-4-3-9(18)8-2-1-7(6-17)5-16-8;1-3-2;1-2/h1-2,5-6,9,18H,3-4H2,(H,15,19);1-2H3;1-2H3 |
| InChIKey | XNTABUWIOVBYDA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|