C27H34F3NO3Si — CID 87600220
N-[3-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]but-2-ynyl]phenyl]-3-hydroxypropyl]-2,2,2-trifluoroacetamide (PubChem CID 87600220) has the molecular formula C27H34F3NO3Si and a molecular weight of 505.65 g/mol. Its IUPAC name is N-[3-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]but-2-ynyl]phenyl]-3-hydroxypropyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]but-2-ynyl]phenyl]-3-hydroxypropyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 87600220 |
| Molecular Formula | C27H34F3NO3Si |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | N-[3-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]but-2-ynyl]phenyl]-3-hydroxypropyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccccc1CC#CCc1cccc(C(O)CCNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C27H34F3NO3Si/c1-26(2,3)35(4,5)34-24-16-9-8-14-21(24)13-7-6-11-20-12-10-15-22(19-20)23(32)17-18-31-25(33)27(28,29)30/h8-10,12,14-16,19,23,32H,11,13,17-18H2,1-5H3,(H,31,33) |
| InChIKey | IGXRQVWCRJGIES-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|