C21H28F3NO4 — CID 86628465
2,2,2-trifluoro-N-[3-hydroxy-3-[3-(3-hydroxy-3-propylhex-1-ynyl)-4-methoxyphenyl]propyl]acetamide (PubChem CID 86628465) has the molecular formula C21H28F3NO4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-hydroxy-3-[3-(3-hydroxy-3-propylhex-1-ynyl)-4-methoxyphenyl]propyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-hydroxy-3-[3-(3-hydroxy-3-propylhex-1-ynyl)-4-methoxyphenyl]propyl]acetamide |
|---|---|
| PubChem CID | 86628465 |
| Molecular Formula | C21H28F3NO4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-hydroxy-3-[3-(3-hydroxy-3-propylhex-1-ynyl)-4-methoxyphenyl]propyl]acetamide |
| SMILES | CCCC(O)(C#Cc1cc(C(O)CCNC(=O)C(F)(F)F)ccc1OC)CCC |
| InChI | InChI=1S/C21H28F3NO4/c1-4-10-20(28,11-5-2)12-8-16-14-15(6-7-18(16)29-3)17(26)9-13-25-19(27)21(22,23)24/h6-7,14,17,26,28H,4-5,9-11,13H2,1-3H3,(H,25,27) |
| InChIKey | GTPCFEIPGQMUDB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|