C19H24F3NO2 — CID 76624638
2,2,2-trifluoro-N-[3-[3-(3-hydroxyoct-1-ynyl)phenyl]propyl]acetamide (PubChem CID 76624638) has the molecular formula C19H24F3NO2 and a molecular weight of 355.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-[3-(3-hydroxyoct-1-ynyl)phenyl]propyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-[3-(3-hydroxyoct-1-ynyl)phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 76624638 |
| Molecular Formula | C19H24F3NO2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-[3-(3-hydroxyoct-1-ynyl)phenyl]propyl]acetamide |
| SMILES | CCCCCC(O)C#Cc1cccc(CCCNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C19H24F3NO2/c1-2-3-4-10-17(24)12-11-16-8-5-7-15(14-16)9-6-13-23-18(25)19(20,21)22/h5,7-8,14,17,24H,2-4,6,9-10,13H2,1H3,(H,23,25) |
| InChIKey | IPPKSDLSBIZJST-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|