C18H25F3N2O2 — CID 87344500
2,2,2-trifluoro-N-[3-[3-[(1-hydroxycyclohexyl)methylamino]phenyl]propyl]acetamide (PubChem CID 87344500) has the molecular formula C18H25F3N2O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-[3-[(1-hydroxycyclohexyl)methylamino]phenyl]propyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-[3-[(1-hydroxycyclohexyl)methylamino]phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 87344500 |
| Molecular Formula | C18H25F3N2O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-[3-[(1-hydroxycyclohexyl)methylamino]phenyl]propyl]acetamide |
| SMILES | O=C(NCCCc1cccc(NCC2(O)CCCCC2)c1)C(F)(F)F |
| InChI | InChI=1S/C18H25F3N2O2/c19-18(20,21)16(24)22-11-5-7-14-6-4-8-15(12-14)23-13-17(25)9-2-1-3-10-17/h4,6,8,12,23,25H,1-3,5,7,9-11,13H2,(H,22,24) |
| InChIKey | JMCJSBXRPONCTR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|