C11H14ClNO — CID 131701731
1-[(3-chloroanilino)methyl]cyclobutan-1-ol (PubChem CID 131701731) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 1-[(3-chloroanilino)methyl]cyclobutan-1-ol.
| Compound Name | 1-[(3-chloroanilino)methyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 131701731 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-[(3-chloroanilino)methyl]cyclobutan-1-ol |
| SMILES | OC1(CNc2cccc(Cl)c2)CCC1 |
| InChI | InChI=1S/C11H14ClNO/c12-9-3-1-4-10(7-9)13-8-11(14)5-2-6-11/h1,3-4,7,13-14H,2,5-6,8H2 |
| InChIKey | OKBKJWNLHLJQLZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |