C16H27ClN2O2 — CID 67296595
1-[[3-(3-amino-3-hydroxypropyl)anilino]methyl]cyclohexan-1-ol;hydrochloride (PubChem CID 67296595) has the molecular formula C16H27ClN2O2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 1-[[3-(3-amino-3-hydroxypropyl)anilino]methyl]cyclohexan-1-ol;hydrochloride.
| Compound Name | 1-[[3-(3-amino-3-hydroxypropyl)anilino]methyl]cyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 67296595 |
| Molecular Formula | C16H27ClN2O2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 1-[[3-(3-amino-3-hydroxypropyl)anilino]methyl]cyclohexan-1-ol;hydrochloride |
| SMILES | Cl.NC(O)CCc1cccc(NCC2(O)CCCCC2)c1 |
| InChI | InChI=1S/C16H26N2O2.ClH/c17-15(19)8-7-13-5-4-6-14(11-13)18-12-16(20)9-2-1-3-10-16;/h4-6,11,15,18-20H,1-3,7-10,12,17H2;1H |
| InChIKey | GTDQHOUCXMWOCV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|