C22H30F3NO2 — CID 87082202
2,2,2-trifluoro-N-[3-[3-[3-hydroxy-5-methyl-3-(2-methylpropyl)hex-1-ynyl]phenyl]propyl]acetamide (PubChem CID 87082202) has the molecular formula C22H30F3NO2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-[3-[3-hydroxy-5-methyl-3-(2-methylpropyl)hex-1-ynyl]phenyl]propyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-[3-[3-hydroxy-5-methyl-3-(2-methylpropyl)hex-1-ynyl]phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 87082202 |
| Molecular Formula | C22H30F3NO2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-[3-[3-hydroxy-5-methyl-3-(2-methylpropyl)hex-1-ynyl]phenyl]propyl]acetamide |
| SMILES | CC(C)CC(O)(C#Cc1cccc(CCCNC(=O)C(F)(F)F)c1)CC(C)C |
| InChI | InChI=1S/C22H30F3NO2/c1-16(2)14-21(28,15-17(3)4)11-10-19-8-5-7-18(13-19)9-6-12-26-20(27)22(23,24)25/h5,7-8,13,16-17,28H,6,9,12,14-15H2,1-4H3,(H,26,27) |
| InChIKey | FUUVZNZZRGBVKG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|