C17H27N3OS — CID 144683816
2,3-diamino-N-[4-(3-prop-1-ynylphenyl)butyl]propanamide;methanethiol (PubChem CID 144683816) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is 2,3-diamino-N-[4-(3-prop-1-ynylphenyl)butyl]propanamide;methanethiol.
| Compound Name | 2,3-diamino-N-[4-(3-prop-1-ynylphenyl)butyl]propanamide;methanethiol |
|---|---|
| PubChem CID | 144683816 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2,3-diamino-N-[4-(3-prop-1-ynylphenyl)butyl]propanamide;methanethiol |
| SMILES | CC#Cc1cccc(CCCCNC(=O)C(N)CN)c1.CS |
| InChI | InChI=1S/C16H23N3O.CH4S/c1-2-6-13-8-5-9-14(11-13)7-3-4-10-19-16(20)15(18)12-17;1-2/h5,8-9,11,15H,3-4,7,10,12,17-18H2,1H3,(H,19,20);2H,1H3 |
| InChIKey | LVFTUPFBNJPYIE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|