C24H37N3O3Si — CID 90350686
2,3-bis(propanoylamino)-N-[4-[3-(2-trimethylsilylethynyl)phenyl]butyl]propanamide (PubChem CID 90350686) has the molecular formula C24H37N3O3Si and a molecular weight of 443.66 g/mol. Its IUPAC name is 2,3-bis(propanoylamino)-N-[4-[3-(2-trimethylsilylethynyl)phenyl]butyl]propanamide.
| Compound Name | 2,3-bis(propanoylamino)-N-[4-[3-(2-trimethylsilylethynyl)phenyl]butyl]propanamide |
|---|---|
| PubChem CID | 90350686 |
| Molecular Formula | C24H37N3O3Si |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 2,3-bis(propanoylamino)-N-[4-[3-(2-trimethylsilylethynyl)phenyl]butyl]propanamide |
| SMILES | CCC(=O)NCC(NC(=O)CC)C(=O)NCCCCc1cccc(C#C[Si](C)(C)C)c1 |
| InChI | InChI=1S/C24H37N3O3Si/c1-6-22(28)26-18-21(27-23(29)7-2)24(30)25-15-9-8-11-19-12-10-13-20(17-19)14-16-31(3,4)5/h10,12-13,17,21H,6-9,11,15,18H2,1-5H3,(H,25,30)(H,26,28)(H,27,29) |
| InChIKey | XPQIKZMPPRZBQL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|