C15H21NO3Si — CID 89499587
[(2S)-1-hydroxy-3-[3-(2-trimethylsilylethynyl)phenyl]propan-2-yl]carbamic acid (PubChem CID 89499587) has the molecular formula C15H21NO3Si and a molecular weight of 291.42 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-[3-(2-trimethylsilylethynyl)phenyl]propan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-hydroxy-3-[3-(2-trimethylsilylethynyl)phenyl]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 89499587 |
| Molecular Formula | C15H21NO3Si |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | [(2S)-1-hydroxy-3-[3-(2-trimethylsilylethynyl)phenyl]propan-2-yl]carbamic acid |
| SMILES | C[Si](C)(C)C#Cc1cccc(C[C@@H](CO)NC(=O)O)c1 |
| InChI | InChI=1S/C15H21NO3Si/c1-20(2,3)8-7-12-5-4-6-13(9-12)10-14(11-17)16-15(18)19/h4-6,9,14,16-17H,10-11H2,1-3H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | KUGDGZBJRFENIU-AWEZNQCLSA-N |
| XLogP | 2.09 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|