C27H38N2O3Si — CID 68958578
tert-butyl N-[3-hydroxy-1-phenyl-4-[[3-(2-trimethylsilylethynyl)phenyl]methylamino]butan-2-yl]carbamate (PubChem CID 68958578) has the molecular formula C27H38N2O3Si and a molecular weight of 466.70 g/mol. Its IUPAC name is tert-butyl N-[3-hydroxy-1-phenyl-4-[[3-(2-trimethylsilylethynyl)phenyl]methylamino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-hydroxy-1-phenyl-4-[[3-(2-trimethylsilylethynyl)phenyl]methylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 68958578 |
| Molecular Formula | C27H38N2O3Si |
| Molecular Weight | 466.70 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | tert-butyl N-[3-hydroxy-1-phenyl-4-[[3-(2-trimethylsilylethynyl)phenyl]methylamino]butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(O)CNCc1cccc(C#C[Si](C)(C)C)c1 |
| InChI | InChI=1S/C27H38N2O3Si/c1-27(2,3)32-26(31)29-24(18-21-11-8-7-9-12-21)25(30)20-28-19-23-14-10-13-22(17-23)15-16-33(4,5)6/h7-14,17,24-25,28,30H,18-20H2,1-6H3,(H,29,31) |
| InChIKey | KXEBRJGDILFTCD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.70 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|