C16H17ClS — CID 63460569
2-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-5-ethylthiophene (PubChem CID 63460569) has the molecular formula C16H17ClS and a molecular weight of 276.83 g/mol. Its IUPAC name is 2-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-5-ethylthiophene.
| Compound Name | 2-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-5-ethylthiophene |
|---|---|
| PubChem CID | 63460569 |
| Molecular Formula | C16H17ClS |
| Molecular Weight | 276.83 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-5-ethylthiophene |
| SMILES | CCc1ccc(CC2Cc3ccccc3C2Cl)s1 |
| InChI | InChI=1S/C16H17ClS/c1-2-13-7-8-14(18-13)10-12-9-11-5-3-4-6-15(11)16(12)17/h3-8,12,16H,2,9-10H2,1H3 |
| InChIKey | NKZBFCLWDZSTEJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.83 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|