C13H17Cl — CID 63460579
1-chloro-2-propyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 63460579) has the molecular formula C13H17Cl and a molecular weight of 208.73 g/mol. Its IUPAC name is 1-chloro-2-propyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-chloro-2-propyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 63460579 |
| Molecular Formula | C13H17Cl |
| Molecular Weight | 208.73 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-chloro-2-propyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCC1CCc2ccccc2C1Cl |
| InChI | InChI=1S/C13H17Cl/c1-2-5-11-9-8-10-6-3-4-7-12(10)13(11)14/h3-4,6-7,11,13H,2,5,8-9H2,1H3 |
| InChIKey | BCBGTIYDNZYNQO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.73 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|