C18H18Cl2 — CID 106869188
1-chloro-2-[(2-chloro-4-methylphenyl)methyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 106869188) has the molecular formula C18H18Cl2 and a molecular weight of 305.25 g/mol. Its IUPAC name is 1-chloro-2-[(2-chloro-4-methylphenyl)methyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-chloro-2-[(2-chloro-4-methylphenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 106869188 |
| Molecular Formula | C18H18Cl2 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 1-chloro-2-[(2-chloro-4-methylphenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1ccc(CC2CCc3ccccc3C2Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2/c1-12-6-7-14(17(19)10-12)11-15-9-8-13-4-2-3-5-16(13)18(15)20/h2-7,10,15,18H,8-9,11H2,1H3 |
| InChIKey | JCTLWACFTMKPNB-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|