C19H21Cl — CID 63459508
1-chloro-2-[(2,5-dimethylphenyl)methyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 63459508) has the molecular formula C19H21Cl and a molecular weight of 284.83 g/mol. Its IUPAC name is 1-chloro-2-[(2,5-dimethylphenyl)methyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-chloro-2-[(2,5-dimethylphenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 63459508 |
| Molecular Formula | C19H21Cl |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-chloro-2-[(2,5-dimethylphenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1ccc(C)c(CC2CCc3ccccc3C2Cl)c1 |
| InChI | InChI=1S/C19H21Cl/c1-13-7-8-14(2)17(11-13)12-16-10-9-15-5-3-4-6-18(15)19(16)20/h3-8,11,16,19H,9-10,12H2,1-2H3 |
| InChIKey | GNQZIFRXQVVNNW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|