C16H21Cl — CID 63459329
1-chloro-2-(cyclopentylmethyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 63459329) has the molecular formula C16H21Cl and a molecular weight of 248.80 g/mol. Its IUPAC name is 1-chloro-2-(cyclopentylmethyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-chloro-2-(cyclopentylmethyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 63459329 |
| Molecular Formula | C16H21Cl |
| Molecular Weight | 248.80 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-chloro-2-(cyclopentylmethyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | ClC1c2ccccc2CCC1CC1CCCC1 |
| InChI | InChI=1S/C16H21Cl/c17-16-14(11-12-5-1-2-6-12)10-9-13-7-3-4-8-15(13)16/h3-4,7-8,12,14,16H,1-2,5-6,9-11H2 |
| InChIKey | XGRYWTLCSWCPBI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.80 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|