C19H19ClS — CID 79214566
3-[(1-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-2,3-dihydro-1-benzothiophene (PubChem CID 79214566) has the molecular formula C19H19ClS and a molecular weight of 314.88 g/mol. Its IUPAC name is 3-[(1-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-2,3-dihydro-1-benzothiophene.
| Compound Name | 3-[(1-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 79214566 |
| Molecular Formula | C19H19ClS |
| Molecular Weight | 314.88 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3-[(1-chloro-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-2,3-dihydro-1-benzothiophene |
| SMILES | ClC1c2ccccc2CCC1CC1CSc2ccccc21 |
| InChI | InChI=1S/C19H19ClS/c20-19-14(10-9-13-5-1-2-7-17(13)19)11-15-12-21-18-8-4-3-6-16(15)18/h1-8,14-15,19H,9-12H2 |
| InChIKey | OXUIQVMLOWWDND-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.88 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|