C13H15BrS2 — CID 83190532
3-[(4-bromothiolan-3-yl)methyl]-2,3-dihydro-1-benzothiophene (PubChem CID 83190532) has the molecular formula C13H15BrS2 and a molecular weight of 315.30 g/mol. Its IUPAC name is 3-[(4-bromothiolan-3-yl)methyl]-2,3-dihydro-1-benzothiophene.
| Compound Name | 3-[(4-bromothiolan-3-yl)methyl]-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 83190532 |
| Molecular Formula | C13H15BrS2 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 3-[(4-bromothiolan-3-yl)methyl]-2,3-dihydro-1-benzothiophene |
| SMILES | BrC1CSCC1CC1CSc2ccccc21 |
| InChI | InChI=1S/C13H15BrS2/c14-12-8-15-6-10(12)5-9-7-16-13-4-2-1-3-11(9)13/h1-4,9-10,12H,5-8H2 |
| InChIKey | HADBKWCGNXNPGF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|