C16H20BrNS — CID 80668610
3-bromo-8-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-8-azabicyclo[3.2.1]octane (PubChem CID 80668610) has the molecular formula C16H20BrNS and a molecular weight of 338.31 g/mol. Its IUPAC name is 3-bromo-8-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-bromo-8-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 80668610 |
| Molecular Formula | C16H20BrNS |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 3-bromo-8-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-8-azabicyclo[3.2.1]octane |
| SMILES | BrC1CC2CCC(C1)N2CC1CSc2ccccc21 |
| InChI | InChI=1S/C16H20BrNS/c17-12-7-13-5-6-14(8-12)18(13)9-11-10-19-16-4-2-1-3-15(11)16/h1-4,11-14H,5-10H2 |
| InChIKey | SCJOUALGSPNKQX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|