C18H25Cl — CID 63772319
1-[(2-chlorocycloheptyl)methyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 63772319) has the molecular formula C18H25Cl and a molecular weight of 276.85 g/mol. Its IUPAC name is 1-[(2-chlorocycloheptyl)methyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-[(2-chlorocycloheptyl)methyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 63772319 |
| Molecular Formula | C18H25Cl |
| Molecular Weight | 276.85 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-[(2-chlorocycloheptyl)methyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | ClC1CCCCCC1CC1CCCc2ccccc21 |
| InChI | InChI=1S/C18H25Cl/c19-18-12-3-1-2-8-16(18)13-15-10-6-9-14-7-4-5-11-17(14)15/h4-5,7,11,15-16,18H,1-3,6,8-10,12-13H2 |
| InChIKey | FPNRSYRKIBGPEN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.85 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|