C18H26ClN — CID 102637491
2-chloro-N-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)cyclohexan-1-amine (PubChem CID 102637491) has the molecular formula C18H26ClN and a molecular weight of 291.87 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)cyclohexan-1-amine.
| Compound Name | 2-chloro-N-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 102637491 |
| Molecular Formula | C18H26ClN |
| Molecular Weight | 291.87 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-chloro-N-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)cyclohexan-1-amine |
| SMILES | CN(CC1CCCc2ccccc21)C1CCCCC1Cl |
| InChI | InChI=1S/C18H26ClN/c1-20(18-12-5-4-11-17(18)19)13-15-9-6-8-14-7-2-3-10-16(14)15/h2-3,7,10,15,17-18H,4-6,8-9,11-13H2,1H3 |
| InChIKey | HFKSFCUHHUHPLY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.87 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|