About 3-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-2,3-dihydro-1-benzofuran
3-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 79219731) has the molecular formula C18H17ClO
and a molecular weight of 284.79 g/mol. Its IUPAC name is 3-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 3-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-2,3-dihydro-1-benzofuran |
| PubChem CID | 79219731 |
| Molecular Formula | C18H17ClO |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 3-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | ClC1c2ccccc2CC1CC1COc2ccccc21 |
| InChI | InChI=1S/C18H17ClO/c19-18-13(9-12-5-1-2-7-16(12)18)10-14-11-20-17-8-4-3-6-15(14)17/h1-8,13-14,18H,9-11H2 |
| InChIKey | SLIBRKAIHVJKNK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-2,3-dihydro-1-benzofuran?
The IUPAC name of 3-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-2,3-dihydro-1-benzofuran (CID 79219731) is 3-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 3-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-2,3-dihydro-1-benzofuran?
The canonical SMILES for 3-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-2,3-dihydro-1-benzofuran is ClC1c2ccccc2CC1CC1COc2ccccc21.
What is the InChIKey of 3-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-2,3-dihydro-1-benzofuran?
The InChIKey is SLIBRKAIHVJKNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClO/c19-18-13(9-12-5-1-2-7-16(12)18)10-14-11-20-17-8-4-3-6-15(14)17/h1-8,13-14,18H,9-11H2.
What are the key properties of 3-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-2,3-dihydro-1-benzofuran?
3-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-2,3-dihydro-1-benzofuran has a molecular weight of 284.79 g/mol, XLogP of 4.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-chloro-2,3-dihydro-1H-inden-2-yl)methyl]-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 79219731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).