C21H22O3 — CID 126641752
[4-[4-(7-bicyclo[4.2.0]octa-1,3,5-trienyloxy)butyl]phenyl] prop-2-enoate (PubChem CID 126641752) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is [4-[4-(7-bicyclo[4.2.0]octa-1,3,5-trienyloxy)butyl]phenyl] prop-2-enoate.
| Compound Name | [4-[4-(7-bicyclo[4.2.0]octa-1,3,5-trienyloxy)butyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 126641752 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [4-[4-(7-bicyclo[4.2.0]octa-1,3,5-trienyloxy)butyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(CCCCOC2Cc3ccccc32)cc1 |
| InChI | InChI=1S/C21H22O3/c1-2-21(22)24-18-12-10-16(11-13-18)7-5-6-14-23-20-15-17-8-3-4-9-19(17)20/h2-4,8-13,20H,1,5-7,14-15H2 |
| InChIKey | HVJOSHIGWJCENX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|