C22H28N2O — CID 2332403
N-[(2R,4R)-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl]-N-phenylhexanamide (PubChem CID 2332403) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is N-[(2R,4R)-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl]-N-phenylhexanamide.
| Compound Name | N-[(2R,4R)-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl]-N-phenylhexanamide |
|---|---|
| PubChem CID | 2332403 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N-[(2R,4R)-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl]-N-phenylhexanamide |
| SMILES | CCCCCC(=O)N(c1ccccc1)[C@@H]1C[C@@H](C)Nc2ccccc21 |
| InChI | InChI=1S/C22H28N2O/c1-3-4-6-15-22(25)24(18-11-7-5-8-12-18)21-16-17(2)23-20-14-10-9-13-19(20)21/h5,7-14,17,21,23H,3-4,6,15-16H2,1-2H3/t17-,21-/m1/s1 |
| InChIKey | CWMXHTLZBUQINT-DYESRHJHSA-N |
| XLogP | 5.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|