About 2-(fluoromethyl)-2,3-dihydro-1H-indene
2-(fluoromethyl)-2,3-dihydro-1H-indene (PubChem CID 90836349) has the molecular formula C10H11F
and a molecular weight of 150.20 g/mol. Its IUPAC name is 2-(fluoromethyl)-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 2-(fluoromethyl)-2,3-dihydro-1H-indene |
| PubChem CID | 90836349 |
| Molecular Formula | C10H11F |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 2-(fluoromethyl)-2,3-dihydro-1H-indene |
| SMILES | FCC1Cc2ccccc2C1 |
| InChI | InChI=1S/C10H11F/c11-7-8-5-9-3-1-2-4-10(9)6-8/h1-4,8H,5-7H2 |
| InChIKey | VJNDAHNIALYMHO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(fluoromethyl)-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(fluoromethyl)-2,3-dihydro-1H-indene?
The IUPAC name of 2-(fluoromethyl)-2,3-dihydro-1H-indene (CID 90836349) is 2-(fluoromethyl)-2,3-dihydro-1H-indene.
What is the SMILES notation for 2-(fluoromethyl)-2,3-dihydro-1H-indene?
The canonical SMILES for 2-(fluoromethyl)-2,3-dihydro-1H-indene is FCC1Cc2ccccc2C1.
What is the InChIKey of 2-(fluoromethyl)-2,3-dihydro-1H-indene?
The InChIKey is VJNDAHNIALYMHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F/c11-7-8-5-9-3-1-2-4-10(9)6-8/h1-4,8H,5-7H2.
What are the key properties of 2-(fluoromethyl)-2,3-dihydro-1H-indene?
2-(fluoromethyl)-2,3-dihydro-1H-indene has a molecular weight of 150.20 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethyl)-2,3-dihydro-1H-indene is sourced from PubChem (CID 90836349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).