C10H11F — CID 90836349
2-(fluoromethyl)-2,3-dihydro-1H-indene (PubChem CID 90836349) has the molecular formula C10H11F and a molecular weight of 150.20 g/mol. Its IUPAC name is 2-(fluoromethyl)-2,3-dihydro-1H-indene.
| Compound Name | 2-(fluoromethyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 90836349 |
| Molecular Formula | C10H11F |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 2-(fluoromethyl)-2,3-dihydro-1H-indene |
| SMILES | FCC1Cc2ccccc2C1 |
| InChI | InChI=1S/C10H11F/c11-7-8-5-9-3-1-2-4-10(9)6-8/h1-4,8H,5-7H2 |
| InChIKey | VJNDAHNIALYMHO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |