C17H26O — CID 91364576
ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one (PubChem CID 91364576) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one.
| Compound Name | ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one |
|---|---|
| PubChem CID | 91364576 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one |
| SMILES | CC.CC.O=C1C2CCC1Cc1ccccc1C2 |
| InChI | InChI=1S/C13H14O.2C2H6/c14-13-11-5-6-12(13)8-10-4-2-1-3-9(10)7-11;2*1-2/h1-4,11-12H,5-8H2;2*1-2H3 |
| InChIKey | ONBKPOQGALCGRU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |