About ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one
ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one (PubChem CID 91364576) has the molecular formula C17H26O
and a molecular weight of 246.39 g/mol. Its IUPAC name is ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one.
Molecular Properties
| Compound Name | ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one |
| PubChem CID | 91364576 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one |
| SMILES | CC.CC.O=C1C2CCC1Cc1ccccc1C2 |
| InChI | InChI=1S/C13H14O.2C2H6/c14-13-11-5-6-12(13)8-10-4-2-1-3-9(10)7-11;2*1-2/h1-4,11-12H,5-8H2;2*1-2H3 |
| InChIKey | ONBKPOQGALCGRU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one?
The IUPAC name of ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one (CID 91364576) is ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one.
What is the SMILES notation for ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one?
The canonical SMILES for ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one is CC.CC.O=C1C2CCC1Cc1ccccc1C2.
What is the InChIKey of ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one?
The InChIKey is ONBKPOQGALCGRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O.2C2H6/c14-13-11-5-6-12(13)8-10-4-2-1-3-9(10)7-11;2*1-2/h1-4,11-12H,5-8H2;2*1-2H3.
What are the key properties of ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one?
ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one has a molecular weight of 246.39 g/mol, XLogP of 4.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one is sourced from PubChem (CID 91364576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).