C15H24N2O5S — CID 59408690
3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-N-(4-sulfamoylphenyl)propanamide (PubChem CID 59408690) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is 3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 59408690 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-N-(4-sulfamoylphenyl)propanamide |
| SMILES | CC(C)(C)OCCOCCC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H24N2O5S/c1-15(2,3)22-11-10-21-9-8-14(18)17-12-4-6-13(7-5-12)23(16,19)20/h4-7H,8-11H2,1-3H3,(H,17,18)(H2,16,19,20) |
| InChIKey | PKLRJCOHAFGCRE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|