C17H27NO5S — CID 162202793
4-[5-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-oxopentyl]benzenesulfonamide (PubChem CID 162202793) has the molecular formula C17H27NO5S and a molecular weight of 357.47 g/mol. Its IUPAC name is 4-[5-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-oxopentyl]benzenesulfonamide.
| Compound Name | 4-[5-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-oxopentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 162202793 |
| Molecular Formula | C17H27NO5S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-[5-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-oxopentyl]benzenesulfonamide |
| SMILES | CC(C)(C)OCCOCCC(=O)CCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H27NO5S/c1-17(2,3)23-13-12-22-11-10-15(19)7-4-14-5-8-16(9-6-14)24(18,20)21/h5-6,8-9H,4,7,10-13H2,1-3H3,(H2,18,20,21) |
| InChIKey | ZRUNUGMCLGFOHI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|