C37H44N4O11S — CID 126962006
N-[3-oxo-3-[4-[4-[3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]benzoyl]anilino]propyl]-4-sulfamoylbenzamide (PubChem CID 126962006) has the molecular formula C37H44N4O11S and a molecular weight of 752.84 g/mol. Its IUPAC name is N-[3-oxo-3-[4-[4-[3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]benzoyl]anilino]propyl]-4-sulfamoylbenzamide.
| Compound Name | N-[3-oxo-3-[4-[4-[3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]benzoyl]anilino]propyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 126962006 |
| Molecular Formula | C37H44N4O11S |
| Molecular Weight | 752.84 g/mol |
| Exact Mass | 752.27 |
| IUPAC Name | N-[3-oxo-3-[4-[4-[3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]propanoylamino]benzoyl]anilino]propyl]-4-sulfamoylbenzamide |
| SMILES | C#CCOCCOCCOCCOCCOCCC(=O)Nc1ccc(C(=O)c2ccc(NC(=O)CCNC(=O)c3ccc(S(N)(=O)=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H44N4O11S/c1-2-18-48-20-22-50-24-26-52-27-25-51-23-21-49-19-16-35(43)41-32-11-5-29(6-12-32)36(44)28-3-9-31(10-4-28)40-34(42)15-17-39-37(45)30-7-13-33(14-8-30)53(38,46)47/h1,3-14H,15-27H2,(H,39,45)(H,40,42)(H,41,43)(H2,38,46,47) |
| InChIKey | VIYUVDRQUZFJFN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 210.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.84 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|