C22H26ClN5O3S — CID 45259380
N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-nitrobenzamide;hydrochloride (PubChem CID 45259380) has the molecular formula C22H26ClN5O3S and a molecular weight of 476.00 g/mol. Its IUPAC name is N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-nitrobenzamide;hydrochloride.
| Compound Name | N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 45259380 |
| Molecular Formula | C22H26ClN5O3S |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-2-nitrobenzamide;hydrochloride |
| SMILES | Cl.O=C(NCCCCN1CCN(c2nsc3ccccc23)CC1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25N5O3S.ClH/c28-22(17-7-1-3-9-19(17)27(29)30)23-11-5-6-12-25-13-15-26(16-14-25)21-18-8-2-4-10-20(18)31-24-21;/h1-4,7-10H,5-6,11-16H2,(H,23,28);1H |
| InChIKey | BUPOFWIUPYGRKI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|