C23H30ClN5O2S — CID 45259374
2-amino-N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-5-methoxybenzamide;hydrochloride (PubChem CID 45259374) has the molecular formula C23H30ClN5O2S and a molecular weight of 476.05 g/mol. Its IUPAC name is 2-amino-N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-5-methoxybenzamide;hydrochloride.
| Compound Name | 2-amino-N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-5-methoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 45259374 |
| Molecular Formula | C23H30ClN5O2S |
| Molecular Weight | 476.05 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-amino-N-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-5-methoxybenzamide;hydrochloride |
| SMILES | COc1ccc(N)c(C(=O)NCCCCN2CCN(c3nsc4ccccc34)CC2)c1.Cl |
| InChI | InChI=1S/C23H29N5O2S.ClH/c1-30-17-8-9-20(24)19(16-17)23(29)25-10-4-5-11-27-12-14-28(15-13-27)22-18-6-2-3-7-21(18)31-26-22;/h2-3,6-9,16H,4-5,10-15,24H2,1H3,(H,25,29);1H |
| InChIKey | PLUIZSLMPDNSCS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.05 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|