C22H28ClN5OS — CID 67835617
2-amino-N-[4-[4-(2,1-benzothiazol-3-yl)piperazin-1-yl]butyl]benzamide;hydrochloride (PubChem CID 67835617) has the molecular formula C22H28ClN5OS and a molecular weight of 446.02 g/mol. Its IUPAC name is 2-amino-N-[4-[4-(2,1-benzothiazol-3-yl)piperazin-1-yl]butyl]benzamide;hydrochloride.
| Compound Name | 2-amino-N-[4-[4-(2,1-benzothiazol-3-yl)piperazin-1-yl]butyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 67835617 |
| Molecular Formula | C22H28ClN5OS |
| Molecular Weight | 446.02 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 2-amino-N-[4-[4-(2,1-benzothiazol-3-yl)piperazin-1-yl]butyl]benzamide;hydrochloride |
| SMILES | Cl.Nc1ccccc1C(=O)NCCCCN1CCN(c2snc3ccccc23)CC1 |
| InChI | InChI=1S/C22H27N5OS.ClH/c23-19-9-3-1-7-17(19)21(28)24-11-5-6-12-26-13-15-27(16-14-26)22-18-8-2-4-10-20(18)25-29-22;/h1-4,7-10H,5-6,11-16,23H2,(H,24,28);1H |
| InChIKey | IMXVPJSNXKIPTC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.02 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|