C17H21N5O2 — CID 22542049
6-N-(1,3-benzodioxol-5-yl)-4-N-cyclohexylpyrimidine-4,5,6-triamine (PubChem CID 22542049) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 6-N-(1,3-benzodioxol-5-yl)-4-N-cyclohexylpyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(1,3-benzodioxol-5-yl)-4-N-cyclohexylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22542049 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 6-N-(1,3-benzodioxol-5-yl)-4-N-cyclohexylpyrimidine-4,5,6-triamine |
| SMILES | Nc1c(Nc2ccc3c(c2)OCO3)ncnc1NC1CCCCC1 |
| InChI | InChI=1S/C17H21N5O2/c18-15-16(21-11-4-2-1-3-5-11)19-9-20-17(15)22-12-6-7-13-14(8-12)24-10-23-13/h6-9,11H,1-5,10,18H2,(H2,19,20,21,22) |
| InChIKey | OCXOBCDPWGEKJW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |