C11H20N4O3 — CID 113467648
2-[(5-amino-6-ethoxypyrimidin-4-yl)-(2-methoxyethyl)amino]ethanol (PubChem CID 113467648) has the molecular formula C11H20N4O3 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-[(5-amino-6-ethoxypyrimidin-4-yl)-(2-methoxyethyl)amino]ethanol.
| Compound Name | 2-[(5-amino-6-ethoxypyrimidin-4-yl)-(2-methoxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 113467648 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-[(5-amino-6-ethoxypyrimidin-4-yl)-(2-methoxyethyl)amino]ethanol |
| SMILES | CCOc1ncnc(N(CCO)CCOC)c1N |
| InChI | InChI=1S/C11H20N4O3/c1-3-18-11-9(12)10(13-8-14-11)15(4-6-16)5-7-17-2/h8,16H,3-7,12H2,1-2H3 |
| InChIKey | NTLZGRPUTWJZFY-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |