C27H49N5O10 — CID 58462486
5-acetyl-3,6-bis[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propylamino]pyrazine-2-carboxamide (PubChem CID 58462486) has the molecular formula C27H49N5O10 and a molecular weight of 603.71 g/mol. Its IUPAC name is 5-acetyl-3,6-bis[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propylamino]pyrazine-2-carboxamide.
| Compound Name | 5-acetyl-3,6-bis[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propylamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 58462486 |
| Molecular Formula | C27H49N5O10 |
| Molecular Weight | 603.71 g/mol |
| Exact Mass | 603.35 |
| IUPAC Name | 5-acetyl-3,6-bis[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propylamino]pyrazine-2-carboxamide |
| SMILES | COCCOCCOCCOCCCNc1nc(C(N)=O)c(NCCCOCCOCCOCCOC)nc1C(C)=O |
| InChI | InChI=1S/C27H49N5O10/c1-22(33)23-26(29-6-4-8-37-14-16-41-20-18-39-12-10-35-2)32-24(25(28)34)27(31-23)30-7-5-9-38-15-17-42-21-19-40-13-11-36-3/h4-21H2,1-3H3,(H2,28,34)(H,29,32)(H,30,31) |
| InChIKey | XCSDFEPJZYVIRA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 183.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.71 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|