C10H10F3N3O5 — CID 114404148
5-nitro-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-2-carboxylic acid (PubChem CID 114404148) has the molecular formula C10H10F3N3O5 and a molecular weight of 309.20 g/mol. Its IUPAC name is 5-nitro-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-2-carboxylic acid.
| Compound Name | 5-nitro-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 114404148 |
| Molecular Formula | C10H10F3N3O5 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 5-nitro-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c(NCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H10F3N3O5/c11-10(12,13)5-21-4-3-14-8-7(16(19)20)2-1-6(15-8)9(17)18/h1-2H,3-5H2,(H,14,15)(H,17,18) |
| InChIKey | RNYUICZIJJMFPN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|