C11H13F3N2O3 — CID 81244294
6-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carboxylic acid (PubChem CID 81244294) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 6-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carboxylic acid.
| Compound Name | 6-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81244294 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 6-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carboxylic acid |
| SMILES | Cc1cc(NCCOCC(F)(F)F)c(C(=O)O)cn1 |
| InChI | InChI=1S/C11H13F3N2O3/c1-7-4-9(8(5-16-7)10(17)18)15-2-3-19-6-11(12,13)14/h4-5H,2-3,6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | ISOVFMZUVHTXEJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|