2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid

C15H12Cl2FNO2 — CID 63537644

IUPAC2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid
SMILESO=C(O)c1cccc(F)c1NCCc1ccc(Cl)cc1Cl
InChIInChI=1S/C15H12Cl2FNO2/c16-10-5-4-9(12(17)8-10)6-7-19-14-11(15(20)21)2-1-3-13(14)18/h1-5,8,19H,6-7H2,(H,20,21)
InChIKeyTVYOXABTQWHETC-UHFFFAOYSA-N
MW328.17 g/mol
LogP4.49
Rot. Bonds5

About 2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid

2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid (PubChem CID 63537644) has the molecular formula C15H12Cl2FNO2 and a molecular weight of 328.17 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid.

Molecular Properties

Compound Name2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid
PubChem CID63537644
Molecular FormulaC15H12Cl2FNO2
Molecular Weight328.17 g/mol
Exact Mass327.02
IUPAC Name2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid
SMILESO=C(O)c1cccc(F)c1NCCc1ccc(Cl)cc1Cl
InChIInChI=1S/C15H12Cl2FNO2/c16-10-5-4-9(12(17)8-10)6-7-19-14-11(15(20)21)2-1-3-13(14)18/h1-5,8,19H,6-7H2,(H,20,21)
InChIKeyTVYOXABTQWHETC-UHFFFAOYSA-N
XLogP4.49
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.17
LogP ≤ 54.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid?
The IUPAC name of 2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid (CID 63537644) is 2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid.
What is the SMILES notation for 2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid?
The canonical SMILES for 2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid is O=C(O)c1cccc(F)c1NCCc1ccc(Cl)cc1Cl.
What is the InChIKey of 2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid?
The InChIKey is TVYOXABTQWHETC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2FNO2/c16-10-5-4-9(12(17)8-10)6-7-19-14-11(15(20)21)2-1-3-13(14)18/h1-5,8,19H,6-7H2,(H,20,21).
What are the key properties of 2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid?
2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid has a molecular weight of 328.17 g/mol, XLogP of 4.49, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-dichlorophenyl)ethylamino]-3-fluorobenzoic acid is sourced from PubChem (CID 63537644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).